C30H48O3 — CID 11995065
(1S,4S,5R,8R,9R,10S,13S,14R,17R,18R,19S,20R)-9-(hydroxymethyl)-4,5,9,13,19,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-ol (PubChem CID 11995065) has the molecular formula C30H48O3 and a molecular weight of 456.71 g/mol. Its IUPAC name is (1S,4S,5R,8R,9R,10S,13S,14R,17R,18R,19S,20R)-9-(hydroxymethyl)-4,5,9,13,19,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-ol.
| Compound Name | (1S,4S,5R,8R,9R,10S,13S,14R,17R,18R,19S,20R)-9-(hydroxymethyl)-4,5,9,13,19,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-ol |
|---|---|
| PubChem CID | 11995065 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | (1S,4S,5R,8R,9R,10S,13S,14R,17R,18R,19S,20R)-9-(hydroxymethyl)-4,5,9,13,19,20-hexamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-ol |
| SMILES | C[C@H]1[C@H](C)CC[C@@]23CC[C@@]4(C)[C@]5(C)CC[C@@H]6[C@](C)(CC[C@H](O)[C@@]6(C)CO)[C@H]5C=C[C@@]4(OC2)[C@H]13 |
| InChI | InChI=1S/C30H48O3/c1-19-7-13-29-16-15-28(6)27(5)12-8-21-25(3,11-10-23(32)26(21,4)17-31)22(27)9-14-30(28,33-18-29)24(29)20(19)2/h9,14,19-24,31-32H,7-8,10-13,15-18H2,1-6H3/t19-,20+,21-,22-,23+,24-,25+,26+,27-,28+,29-,30-/m1/s1 |
| InChIKey | YLRBQSHMAKWGAM-GTHKMNLCSA-N |
| XLogP | 5.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|