C21H23BrN4O2 — CID 11995102
(3S,4S)-3-[(1S,2S)-2-azido-1-hydroxybutyl]-3-bromo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-2-one (PubChem CID 11995102) has the molecular formula C21H23BrN4O2 and a molecular weight of 443.35 g/mol. Its IUPAC name is (3S,4S)-3-[(1S,2S)-2-azido-1-hydroxybutyl]-3-bromo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-2-one.
| Compound Name | (3S,4S)-3-[(1S,2S)-2-azido-1-hydroxybutyl]-3-bromo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-2-one |
|---|---|
| PubChem CID | 11995102 |
| Molecular Formula | C21H23BrN4O2 |
| Molecular Weight | 443.35 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (3S,4S)-3-[(1S,2S)-2-azido-1-hydroxybutyl]-3-bromo-4-phenyl-1-[(1S)-1-phenylethyl]azetidin-2-one |
| SMILES | CC[C@H](N=[N+]=[N-])[C@H](O)[C@]1(Br)C(=O)N([C@@H](C)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H23BrN4O2/c1-3-17(24-25-23)19(27)21(22)18(16-12-8-5-9-13-16)26(20(21)28)14(2)15-10-6-4-7-11-15/h4-14,17-19,27H,3H2,1-2H3/t14-,17-,18-,19-,21-/m0/s1 |
| InChIKey | UAPYDHGDPWJEET-LJZWMIMPSA-N |
| XLogP | 4.91 |
| TPSA | 89.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.35 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|