C18H22N4O4 — CID 11995104
ethyl 3-[(2R,3R,6S)-2-[(1R)-1-azidopropyl]-4-oxo-6-phenyl-1-oxa-5-azaspiro[2.3]hexan-5-yl]propanoate (PubChem CID 11995104) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is ethyl 3-[(2R,3R,6S)-2-[(1R)-1-azidopropyl]-4-oxo-6-phenyl-1-oxa-5-azaspiro[2.3]hexan-5-yl]propanoate.
| Compound Name | ethyl 3-[(2R,3R,6S)-2-[(1R)-1-azidopropyl]-4-oxo-6-phenyl-1-oxa-5-azaspiro[2.3]hexan-5-yl]propanoate |
|---|---|
| PubChem CID | 11995104 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | ethyl 3-[(2R,3R,6S)-2-[(1R)-1-azidopropyl]-4-oxo-6-phenyl-1-oxa-5-azaspiro[2.3]hexan-5-yl]propanoate |
| SMILES | CCOC(=O)CCN1C(=O)[C@@]2(O[C@@H]2[C@@H](CC)N=[N+]=[N-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H22N4O4/c1-3-13(20-21-19)16-18(26-16)15(12-8-6-5-7-9-12)22(17(18)24)11-10-14(23)25-4-2/h5-9,13,15-16H,3-4,10-11H2,1-2H3/t13-,15+,16-,18-/m1/s1 |
| InChIKey | XUFVQQQUHJYBBW-NOVWEMISSA-N |
| XLogP | 2.75 |
| TPSA | 107.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|