C17H24Cl2N4O — CID 119953108
3-amino-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-phenylpropanamide;dihydrochloride (PubChem CID 119953108) has the molecular formula C17H24Cl2N4O and a molecular weight of 371.31 g/mol. Its IUPAC name is 3-amino-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-phenylpropanamide;dihydrochloride.
| Compound Name | 3-amino-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-phenylpropanamide;dihydrochloride |
|---|---|
| PubChem CID | 119953108 |
| Molecular Formula | C17H24Cl2N4O |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-amino-N-[[2-(dimethylamino)-3-pyridinyl]methyl]-3-phenylpropanamide;dihydrochloride |
| SMILES | CN(C)c1ncccc1CNC(=O)CC(N)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C17H22N4O.2ClH/c1-21(2)17-14(9-6-10-19-17)12-20-16(22)11-15(18)13-7-4-3-5-8-13;;/h3-10,15H,11-12,18H2,1-2H3,(H,20,22);2*1H |
| InChIKey | WNLZIOCVOZYSOA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |