C25H39BrO3 — CID 11995334
[(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-methyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate (PubChem CID 11995334) has the molecular formula C25H39BrO3 and a molecular weight of 467.49 g/mol. Its IUPAC name is [(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-methyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-methyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11995334 |
| Molecular Formula | C25H39BrO3 |
| Molecular Weight | 467.49 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-methyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate |
| SMILES | C=C(COC(=O)C(C)(C)C)[C@H](C)C(=O)C[C@@H](C)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C25H39BrO3/c1-16(20-10-11-21-19(14-26)9-8-12-25(20,21)7)13-22(27)18(3)17(2)15-29-23(28)24(4,5)6/h14,16,18,20-21H,2,8-13,15H2,1,3-7H3/b19-14+/t16-,18+,20-,21+,25-/m1/s1 |
| InChIKey | AMIASYXMTQQYEC-JVANOVJHSA-N |
| XLogP | 6.86 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.49 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|