C28H45BrO3 — CID 11995337
[(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-butyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate (PubChem CID 11995337) has the molecular formula C28H45BrO3 and a molecular weight of 509.57 g/mol. Its IUPAC name is [(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-butyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-butyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11995337 |
| Molecular Formula | C28H45BrO3 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | [(3S,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-butyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate |
| SMILES | C=C(COC(=O)C(C)(C)C)[C@H](CCCC)C(=O)C[C@@H](C)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C28H45BrO3/c1-8-9-12-22(20(3)18-32-26(31)27(4,5)6)25(30)16-19(2)23-13-14-24-21(17-29)11-10-15-28(23,24)7/h17,19,22-24H,3,8-16,18H2,1-2,4-7H3/b21-17+/t19-,22+,23-,24+,28-/m1/s1 |
| InChIKey | HLZTYQIEKQZCOW-ZCVZLSJGSA-N |
| XLogP | 8.03 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|