C19H23N3O3S — CID 119953398
3-amino-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-phenylpropanamide (PubChem CID 119953398) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is 3-amino-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-phenylpropanamide.
| Compound Name | 3-amino-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 119953398 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3-amino-N-[3-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-3-phenylpropanamide |
| SMILES | NC(CC(=O)Nc1cccc(N2CCS(=O)(=O)CC2)c1)c1ccccc1 |
| InChI | InChI=1S/C19H23N3O3S/c20-18(15-5-2-1-3-6-15)14-19(23)21-16-7-4-8-17(13-16)22-9-11-26(24,25)12-10-22/h1-8,13,18H,9-12,14,20H2,(H,21,23) |
| InChIKey | ODEHFBZVHIRMPG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |