C25H33N5O4 — CID 11995351
benzyl N-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)cyclohexyl]carbamate (PubChem CID 11995351) has the molecular formula C25H33N5O4 and a molecular weight of 467.57 g/mol. Its IUPAC name is benzyl N-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 11995351 |
| Molecular Formula | C25H33N5O4 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | benzyl N-[4-(2,6-dioxo-1,3-dipropyl-7H-purin-8-yl)cyclohexyl]carbamate |
| SMILES | CCCn1c(=O)c2[nH]c(C3CCC(NC(=O)OCc4ccccc4)CC3)nc2n(CCC)c1=O |
| InChI | InChI=1S/C25H33N5O4/c1-3-14-29-22-20(23(31)30(15-4-2)25(29)33)27-21(28-22)18-10-12-19(13-11-18)26-24(32)34-16-17-8-6-5-7-9-17/h5-9,18-19H,3-4,10-16H2,1-2H3,(H,26,32)(H,27,28) |
| InChIKey | GNKVWLPYAHCCPN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |