C26H41BrO3 — CID 11995433
[(3R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-ethyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate (PubChem CID 11995433) has the molecular formula C26H41BrO3 and a molecular weight of 481.52 g/mol. Its IUPAC name is [(3R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-ethyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-ethyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11995433 |
| Molecular Formula | C26H41BrO3 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [(3R,6R)-6-[(1R,3aR,4E,7aR)-4-(bromomethylidene)-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3-ethyl-2-methylidene-4-oxoheptyl] 2,2-dimethylpropanoate |
| SMILES | C=C(COC(=O)C(C)(C)C)[C@@H](CC)C(=O)C[C@@H](C)[C@H]1CC[C@H]2/C(=C/Br)CCC[C@]12C |
| InChI | InChI=1S/C26H41BrO3/c1-8-20(18(3)16-30-24(29)25(4,5)6)23(28)14-17(2)21-11-12-22-19(15-27)10-9-13-26(21,22)7/h15,17,20-22H,3,8-14,16H2,1-2,4-7H3/b19-15+/t17-,20-,21-,22+,26-/m1/s1 |
| InChIKey | LYSCDQAWEHBKSS-MEOJFMFCSA-N |
| XLogP | 7.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|