About 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile
2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile (PubChem CID 11995462) has the molecular formula C20H18N2O4
and a molecular weight of 350.37 g/mol. Its IUPAC name is 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile.
Molecular Properties
| Compound Name | 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile |
| PubChem CID | 11995462 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile |
| SMILES | COc1cc2c(c(OC)c1OC)C(C#N)N(C(=O)c1ccccc1)C=C2 |
| InChI | InChI=1S/C20H18N2O4/c1-24-16-11-14-9-10-22(20(23)13-7-5-4-6-8-13)15(12-21)17(14)19(26-3)18(16)25-2/h4-11,15H,1-3H3 |
| InChIKey | GNDKJXHKMIVNJC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile?
The IUPAC name of 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile (CID 11995462) is 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile.
What is the SMILES notation for 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile?
The canonical SMILES for 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile is COc1cc2c(c(OC)c1OC)C(C#N)N(C(=O)c1ccccc1)C=C2.
What is the InChIKey of 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile?
The InChIKey is GNDKJXHKMIVNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O4/c1-24-16-11-14-9-10-22(20(23)13-7-5-4-6-8-13)15(12-21)17(14)19(26-3)18(16)25-2/h4-11,15H,1-3H3.
What are the key properties of 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile?
2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile has a molecular weight of 350.37 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzoyl-6,7,8-trimethoxy-1H-isoquinoline-1-carbonitrile is sourced from PubChem (CID 11995462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).