About (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate
(4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 11995528) has the molecular formula C9H11FN4S
and a molecular weight of 226.28 g/mol. Its IUPAC name is (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate.
Molecular Properties
| Compound Name | (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
| PubChem CID | 11995528 |
| Molecular Formula | C9H11FN4S |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(/N=C(N)N)SCc1ccc(F)cc1 |
| InChI | InChI=1S/C9H11FN4S/c10-7-3-1-6(2-4-7)5-15-9(13)14-8(11)12/h1-4H,5H2,(H5,11,12,13,14) |
| InChIKey | NVKDSQDSZYJQJW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate?
The IUPAC name of (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate (CID 11995528) is (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate.
What is the SMILES notation for (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate?
The canonical SMILES for (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate is [H]/N=C(/N=C(N)N)SCc1ccc(F)cc1.
What is the InChIKey of (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate?
The InChIKey is NVKDSQDSZYJQJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN4S/c10-7-3-1-6(2-4-7)5-15-9(13)14-8(11)12/h1-4H,5H2,(H5,11,12,13,14).
What are the key properties of (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate?
(4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate has a molecular weight of 226.28 g/mol, XLogP of 1.27, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-fluorophenyl)methyl N-(diaminomethylidene)carbamimidothioate is sourced from PubChem (CID 11995528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).