About [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate
[3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate (PubChem CID 11995530) has the molecular formula C11H10F6N4S
and a molecular weight of 344.28 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate.
Molecular Properties
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate |
| PubChem CID | 11995530 |
| Molecular Formula | C11H10F6N4S |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SCc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H10F6N4S/c12-10(13,14)6-1-5(2-7(3-6)11(15,16)17)4-22-9(20)21-8(18)19/h1-3H,4H2,(H5,18,19,20,21) |
| InChIKey | KTMHBNXOHBHKBF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate?
The IUPAC name of [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate (CID 11995530) is [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate.
What is the SMILES notation for [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate?
The canonical SMILES for [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate is [H]/N=C(\N=C(N)N)SCc1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate?
The InChIKey is KTMHBNXOHBHKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F6N4S/c12-10(13,14)6-1-5(2-7(3-6)11(15,16)17)4-22-9(20)21-8(18)19/h1-3H,4H2,(H5,18,19,20,21).
What are the key properties of [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate?
[3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate has a molecular weight of 344.28 g/mol, XLogP of 3.17, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-bis(trifluoromethyl)phenyl]methyl N-(diaminomethylidene)carbamimidothioate is sourced from PubChem (CID 11995530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).