C18H21NO3 — CID 119955311
2-[butan-2-yl-(2-naphthalen-1-ylacetyl)amino]acetic acid (PubChem CID 119955311) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-[butan-2-yl-(2-naphthalen-1-ylacetyl)amino]acetic acid.
| Compound Name | 2-[butan-2-yl-(2-naphthalen-1-ylacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 119955311 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-[butan-2-yl-(2-naphthalen-1-ylacetyl)amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C18H21NO3/c1-3-13(2)19(12-18(21)22)17(20)11-15-9-6-8-14-7-4-5-10-16(14)15/h4-10,13H,3,11-12H2,1-2H3,(H,21,22) |
| InChIKey | ZTYREKMAZPVFPD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |