C19H27N3O — CID 119956327
(2S)-2-amino-N-(cyclohexylmethyl)-3-(1H-indol-3-yl)-N-methylpropanamide (PubChem CID 119956327) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is (2S)-2-amino-N-(cyclohexylmethyl)-3-(1H-indol-3-yl)-N-methylpropanamide.
| Compound Name | (2S)-2-amino-N-(cyclohexylmethyl)-3-(1H-indol-3-yl)-N-methylpropanamide |
|---|---|
| PubChem CID | 119956327 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | (2S)-2-amino-N-(cyclohexylmethyl)-3-(1H-indol-3-yl)-N-methylpropanamide |
| SMILES | CN(CC1CCCCC1)C(=O)[C@@H](N)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H27N3O/c1-22(13-14-7-3-2-4-8-14)19(23)17(20)11-15-12-21-18-10-6-5-9-16(15)18/h5-6,9-10,12,14,17,21H,2-4,7-8,11,13,20H2,1H3/t17-/m0/s1 |
| InChIKey | DLBHUGKOFCUADK-KRWDZBQOSA-N |
| XLogP | 3.08 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |