C19H20N6S — CID 11995658
5-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]-2H-tetrazole (PubChem CID 11995658) has the molecular formula C19H20N6S and a molecular weight of 364.48 g/mol. Its IUPAC name is 5-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]-2H-tetrazole.
| Compound Name | 5-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 11995658 |
| Molecular Formula | C19H20N6S |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 5-[3-[4-(imidazol-1-ylmethyl)phenyl]-5-(2-methylpropyl)thiophen-2-yl]-2H-tetrazole |
| SMILES | CC(C)Cc1cc(-c2ccc(Cn3ccnc3)cc2)c(-c2nn[nH]n2)s1 |
| InChI | InChI=1S/C19H20N6S/c1-13(2)9-16-10-17(18(26-16)19-21-23-24-22-19)15-5-3-14(4-6-15)11-25-8-7-20-12-25/h3-8,10,12-13H,9,11H2,1-2H3,(H,21,22,23,24) |
| InChIKey | QMMKUICFNTWQCR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |