C18H26ClN3OS — CID 119957532
(2S)-2-amino-3-(1H-indol-3-yl)-N-(3-methylsulfanylcyclohexyl)propanamide;hydrochloride (PubChem CID 119957532) has the molecular formula C18H26ClN3OS and a molecular weight of 367.95 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)-N-(3-methylsulfanylcyclohexyl)propanamide;hydrochloride.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-(3-methylsulfanylcyclohexyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119957532 |
| Molecular Formula | C18H26ClN3OS |
| Molecular Weight | 367.95 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)-N-(3-methylsulfanylcyclohexyl)propanamide;hydrochloride |
| SMILES | CSC1CCCC(NC(=O)[C@@H](N)Cc2c[nH]c3ccccc23)C1.Cl |
| InChI | InChI=1S/C18H25N3OS.ClH/c1-23-14-6-4-5-13(10-14)21-18(22)16(19)9-12-11-20-17-8-3-2-7-15(12)17;/h2-3,7-8,11,13-14,16,20H,4-6,9-10,19H2,1H3,(H,21,22);1H/t13?,14?,16-;/m0./s1 |
| InChIKey | SQIBTZZOFZSEAB-ZKMYOKSESA-N |
| XLogP | 3.25 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.95 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |