C17H27N3O3S — CID 119958110
2-amino-N-methyl-4-methylsulfonyl-N-(1-phenylpiperidin-3-yl)butanamide (PubChem CID 119958110) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 2-amino-N-methyl-4-methylsulfonyl-N-(1-phenylpiperidin-3-yl)butanamide.
| Compound Name | 2-amino-N-methyl-4-methylsulfonyl-N-(1-phenylpiperidin-3-yl)butanamide |
|---|---|
| PubChem CID | 119958110 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-amino-N-methyl-4-methylsulfonyl-N-(1-phenylpiperidin-3-yl)butanamide |
| SMILES | CN(C(=O)C(N)CCS(C)(=O)=O)C1CCCN(c2ccccc2)C1 |
| InChI | InChI=1S/C17H27N3O3S/c1-19(17(21)16(18)10-12-24(2,22)23)15-9-6-11-20(13-15)14-7-4-3-5-8-14/h3-5,7-8,15-16H,6,9-13,18H2,1-2H3 |
| InChIKey | JXVNBWSVYZRKFP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |