About 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid
3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid (PubChem CID 11995886) has the molecular formula C20H26FN3O4
and a molecular weight of 391.44 g/mol. Its IUPAC name is 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid |
| PubChem CID | 11995886 |
| Molecular Formula | C20H26FN3O4 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid |
| SMILES | CC1(C)C(=O)N(C(=O)NCC2CCN(CCC(=O)O)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C20H26FN3O4/c1-20(2)15-4-3-14(21)11-16(15)24(18(20)27)19(28)22-12-13-5-8-23(9-6-13)10-7-17(25)26/h3-4,11,13H,5-10,12H2,1-2H3,(H,22,28)(H,25,26) |
| InChIKey | JVVLYTTVJFHIKW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid?
The IUPAC name of 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid (CID 11995886) is 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid.
What is the SMILES notation for 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid?
The canonical SMILES for 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid is CC1(C)C(=O)N(C(=O)NCC2CCN(CCC(=O)O)CC2)c2cc(F)ccc21.
What is the InChIKey of 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid?
The InChIKey is JVVLYTTVJFHIKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26FN3O4/c1-20(2)15-4-3-14(21)11-16(15)24(18(20)27)19(28)22-12-13-5-8-23(9-6-13)10-7-17(25)26/h3-4,11,13H,5-10,12H2,1-2H3,(H,22,28)(H,25,26).
What are the key properties of 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid?
3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid has a molecular weight of 391.44 g/mol, XLogP of 2.35, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[[(6-fluoro-3,3-dimethyl-2-oxoindole-1-carbonyl)amino]methyl]piperidin-1-yl]propanoic acid is sourced from PubChem (CID 11995886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).