C13H20ClFN2O2S — CID 119958904
N-[(1-aminocyclohexyl)methyl]-3-fluorobenzenesulfonamide;hydrochloride (PubChem CID 119958904) has the molecular formula C13H20ClFN2O2S and a molecular weight of 322.83 g/mol. Its IUPAC name is N-[(1-aminocyclohexyl)methyl]-3-fluorobenzenesulfonamide;hydrochloride.
| Compound Name | N-[(1-aminocyclohexyl)methyl]-3-fluorobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119958904 |
| Molecular Formula | C13H20ClFN2O2S |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[(1-aminocyclohexyl)methyl]-3-fluorobenzenesulfonamide;hydrochloride |
| SMILES | Cl.NC1(CNS(=O)(=O)c2cccc(F)c2)CCCCC1 |
| InChI | InChI=1S/C13H19FN2O2S.ClH/c14-11-5-4-6-12(9-11)19(17,18)16-10-13(15)7-2-1-3-8-13;/h4-6,9,16H,1-3,7-8,10,15H2;1H |
| InChIKey | DCKYZGTYXJHHFO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |