C10H15ClN2O3S — CID 119960312
3-acetyl-N-(2-aminoethyl)benzenesulfonamide;hydrochloride (PubChem CID 119960312) has the molecular formula C10H15ClN2O3S and a molecular weight of 278.76 g/mol. Its IUPAC name is 3-acetyl-N-(2-aminoethyl)benzenesulfonamide;hydrochloride.
| Compound Name | 3-acetyl-N-(2-aminoethyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119960312 |
| Molecular Formula | C10H15ClN2O3S |
| Molecular Weight | 278.76 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 3-acetyl-N-(2-aminoethyl)benzenesulfonamide;hydrochloride |
| SMILES | CC(=O)c1cccc(S(=O)(=O)NCCN)c1.Cl |
| InChI | InChI=1S/C10H14N2O3S.ClH/c1-8(13)9-3-2-4-10(7-9)16(14,15)12-6-5-11;/h2-4,7,12H,5-6,11H2,1H3;1H |
| InChIKey | CJTUSFZXVNETPY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.76 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |