C16H14FN5O2 — CID 11996036
2-(7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-N-hydroxypyrimidine-5-carboxamide (PubChem CID 11996036) has the molecular formula C16H14FN5O2 and a molecular weight of 327.32 g/mol. Its IUPAC name is 2-(7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-(7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 11996036 |
| Molecular Formula | C16H14FN5O2 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-(7-fluoro-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CCc3c([nH]c4cc(F)ccc34)C2)nc1 |
| InChI | InChI=1S/C16H14FN5O2/c17-10-1-2-11-12-3-4-22(8-14(12)20-13(11)5-10)16-18-6-9(7-19-16)15(23)21-24/h1-2,5-7,20,24H,3-4,8H2,(H,21,23) |
| InChIKey | APNMZNRKZOKPIE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|