C15H25ClN2O5S2 — CID 119960520
4-(2-ethylsulfonylethoxy)-N-piperidin-4-ylbenzenesulfonamide;hydrochloride (PubChem CID 119960520) has the molecular formula C15H25ClN2O5S2 and a molecular weight of 412.96 g/mol. Its IUPAC name is 4-(2-ethylsulfonylethoxy)-N-piperidin-4-ylbenzenesulfonamide;hydrochloride.
| Compound Name | 4-(2-ethylsulfonylethoxy)-N-piperidin-4-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119960520 |
| Molecular Formula | C15H25ClN2O5S2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-(2-ethylsulfonylethoxy)-N-piperidin-4-ylbenzenesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)CCOc1ccc(S(=O)(=O)NC2CCNCC2)cc1.Cl |
| InChI | InChI=1S/C15H24N2O5S2.ClH/c1-2-23(18,19)12-11-22-14-3-5-15(6-4-14)24(20,21)17-13-7-9-16-10-8-13;/h3-6,13,16-17H,2,7-12H2,1H3;1H |
| InChIKey | UYVXJPOIIAKZDF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |