C8H19ClN2O2S — CID 119961049
N-methyl-1-(1-methylsulfonylpiperidin-3-yl)methanamine;hydrochloride (PubChem CID 119961049) has the molecular formula C8H19ClN2O2S and a molecular weight of 242.77 g/mol. Its IUPAC name is N-methyl-1-(1-methylsulfonylpiperidin-3-yl)methanamine;hydrochloride.
| Compound Name | N-methyl-1-(1-methylsulfonylpiperidin-3-yl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 119961049 |
| Molecular Formula | C8H19ClN2O2S |
| Molecular Weight | 242.77 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-methyl-1-(1-methylsulfonylpiperidin-3-yl)methanamine;hydrochloride |
| SMILES | CNCC1CCCN(S(C)(=O)=O)C1.Cl |
| InChI | InChI=1S/C8H18N2O2S.ClH/c1-9-6-8-4-3-5-10(7-8)13(2,11)12;/h8-9H,3-7H2,1-2H3;1H |
| InChIKey | YUZWNNYJOHPCHX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.77 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |