C14H19Cl2N3O2S — CID 119961304
2-chloro-4-[3-(methylaminomethyl)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride (PubChem CID 119961304) has the molecular formula C14H19Cl2N3O2S and a molecular weight of 364.30 g/mol. Its IUPAC name is 2-chloro-4-[3-(methylaminomethyl)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride.
| Compound Name | 2-chloro-4-[3-(methylaminomethyl)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride |
|---|---|
| PubChem CID | 119961304 |
| Molecular Formula | C14H19Cl2N3O2S |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-chloro-4-[3-(methylaminomethyl)piperidin-1-yl]sulfonylbenzonitrile;hydrochloride |
| SMILES | CNCC1CCCN(S(=O)(=O)c2ccc(C#N)c(Cl)c2)C1.Cl |
| InChI | InChI=1S/C14H18ClN3O2S.ClH/c1-17-9-11-3-2-6-18(10-11)21(19,20)13-5-4-12(8-16)14(15)7-13;/h4-5,7,11,17H,2-3,6,9-10H2,1H3;1H |
| InChIKey | NCRQPXSTYKYUEZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |