C12H19N3O4S2 — CID 119961539
N,N-dimethyl-3-piperazin-1-ylsulfonylbenzenesulfonamide (PubChem CID 119961539) has the molecular formula C12H19N3O4S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is N,N-dimethyl-3-piperazin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N,N-dimethyl-3-piperazin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 119961539 |
| Molecular Formula | C12H19N3O4S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N,N-dimethyl-3-piperazin-1-ylsulfonylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1cccc(S(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C12H19N3O4S2/c1-14(2)20(16,17)11-4-3-5-12(10-11)21(18,19)15-8-6-13-7-9-15/h3-5,10,13H,6-9H2,1-2H3 |
| InChIKey | QJRDDOIPGZGYAO-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |