About N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide
N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide (PubChem CID 119962087) has the molecular formula C8H15N3O2S2
and a molecular weight of 249.36 g/mol. Its IUPAC name is N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 119962087 |
| Molecular Formula | C8H15N3O2S2 |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(C)c(S(=O)(=O)NCCCN)s1 |
| InChI | InChI=1S/C8H15N3O2S2/c1-6-8(14-7(2)11-6)15(12,13)10-5-3-4-9/h10H,3-5,9H2,1-2H3 |
| InChIKey | ZXIZIJHATNQUAY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide (CID 119962087) is N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide is Cc1nc(C)c(S(=O)(=O)NCCCN)s1.
What is the InChIKey of N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide?
The InChIKey is ZXIZIJHATNQUAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O2S2/c1-6-8(14-7(2)11-6)15(12,13)10-5-3-4-9/h10H,3-5,9H2,1-2H3.
What are the key properties of N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide?
N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide has a molecular weight of 249.36 g/mol, XLogP of 0.39, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminopropyl)-2,4-dimethyl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 119962087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).