C13H19ClN2O4S — CID 119962906
methyl 3-[[(3R)-3-aminopyrrolidin-1-yl]sulfonylmethyl]benzoate;hydrochloride (PubChem CID 119962906) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is methyl 3-[[(3R)-3-aminopyrrolidin-1-yl]sulfonylmethyl]benzoate;hydrochloride.
| Compound Name | methyl 3-[[(3R)-3-aminopyrrolidin-1-yl]sulfonylmethyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 119962906 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | methyl 3-[[(3R)-3-aminopyrrolidin-1-yl]sulfonylmethyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1cccc(CS(=O)(=O)N2CC[C@@H](N)C2)c1.Cl |
| InChI | InChI=1S/C13H18N2O4S.ClH/c1-19-13(16)11-4-2-3-10(7-11)9-20(17,18)15-6-5-12(14)8-15;/h2-4,7,12H,5-6,8-9,14H2,1H3;1H/t12-;/m1./s1 |
| InChIKey | MTGRRZFPPOMJGU-UTONKHPSSA-N |
| XLogP | 0.76 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |