About methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride
methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride (PubChem CID 119963499) has the molecular formula C15H19ClN2O4S2
and a molecular weight of 390.91 g/mol. Its IUPAC name is methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride |
| PubChem CID | 119963499 |
| Molecular Formula | C15H19ClN2O4S2 |
| Molecular Weight | 390.91 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride |
| SMILES | COC(=O)c1sc2ccccc2c1S(=O)(=O)N1CCCNCC1.Cl |
| InChI | InChI=1S/C15H18N2O4S2.ClH/c1-21-15(18)13-14(11-5-2-3-6-12(11)22-13)23(19,20)17-9-4-7-16-8-10-17;/h2-3,5-6,16H,4,7-10H2,1H3;1H |
| InChIKey | CBVPFIBTOIGURM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.91 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride?
The IUPAC name of methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride (CID 119963499) is methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride.
What is the SMILES notation for methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride?
The canonical SMILES for methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride is COC(=O)c1sc2ccccc2c1S(=O)(=O)N1CCCNCC1.Cl.
What is the InChIKey of methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride?
The InChIKey is CBVPFIBTOIGURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N2O4S2.ClH/c1-21-15(18)13-14(11-5-2-3-6-12(11)22-13)23(19,20)17-9-4-7-16-8-10-17;/h2-3,5-6,16H,4,7-10H2,1H3;1H.
What are the key properties of methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride?
methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride has a molecular weight of 390.91 g/mol, XLogP of 2.09, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(1,4-diazepan-1-ylsulfonyl)-1-benzothiophene-2-carboxylate;hydrochloride is sourced from PubChem (CID 119963499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).