C9H13Cl3N2O2S2 — CID 119964259
2,5-dichloro-N-piperidin-3-ylthiophene-3-sulfonamide;hydrochloride (PubChem CID 119964259) has the molecular formula C9H13Cl3N2O2S2 and a molecular weight of 351.71 g/mol. Its IUPAC name is 2,5-dichloro-N-piperidin-3-ylthiophene-3-sulfonamide;hydrochloride.
| Compound Name | 2,5-dichloro-N-piperidin-3-ylthiophene-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119964259 |
| Molecular Formula | C9H13Cl3N2O2S2 |
| Molecular Weight | 351.71 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 2,5-dichloro-N-piperidin-3-ylthiophene-3-sulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NC1CCCNC1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C9H12Cl2N2O2S2.ClH/c10-8-4-7(9(11)16-8)17(14,15)13-6-2-1-3-12-5-6;/h4,6,12-13H,1-3,5H2;1H |
| InChIKey | CJZAPVAZJNNRRW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.71 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |