C15H18N6O6S2 — CID 11996762
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(thiophen-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate (PubChem CID 11996762) has the molecular formula C15H18N6O6S2 and a molecular weight of 442.48 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(thiophen-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(thiophen-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate |
|---|---|
| PubChem CID | 11996762 |
| Molecular Formula | C15H18N6O6S2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[6-(thiophen-2-ylmethylamino)purin-9-yl]oxolan-2-yl]methyl sulfamate |
| SMILES | NS(=O)(=O)OC[C@H]1O[C@@H](n2cnc3c(NCc4cccs4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H18N6O6S2/c16-29(24,25)26-5-9-11(22)12(23)15(27-9)21-7-20-10-13(18-6-19-14(10)21)17-4-8-2-1-3-28-8/h1-3,6-7,9,11-12,15,22-23H,4-5H2,(H2,16,24,25)(H,17,18,19)/t9-,11-,12-,15-/m1/s1 |
| InChIKey | DGORRKCQQSWFHY-SDBHATRESA-N |
| XLogP | -0.66 |
| TPSA | 174.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |