About 2-chlorobenzene-1,4-diamine;dihydrochloride
2-chlorobenzene-1,4-diamine;dihydrochloride (PubChem CID 11997) has the molecular formula C6H9Cl3N2
and a molecular weight of 215.51 g/mol. Its IUPAC name is 2-chlorobenzene-1,4-diamine;dihydrochloride.
Molecular Properties
| Compound Name | 2-chlorobenzene-1,4-diamine;dihydrochloride |
| PubChem CID | 11997 |
| Molecular Formula | C6H9Cl3N2 |
| Molecular Weight | 215.51 g/mol |
| Exact Mass | 213.98 |
| IUPAC Name | 2-chlorobenzene-1,4-diamine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(N)c(Cl)c1 |
| InChI | InChI=1S/C6H7ClN2.2ClH/c7-5-3-4(8)1-2-6(5)9;;/h1-3H,8-9H2;2*1H |
| InChIKey | GJCLKJLIKKFYAW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorobenzene-1,4-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzene-1,4-diamine;dihydrochloride?
The IUPAC name of 2-chlorobenzene-1,4-diamine;dihydrochloride (CID 11997) is 2-chlorobenzene-1,4-diamine;dihydrochloride.
What is the SMILES notation for 2-chlorobenzene-1,4-diamine;dihydrochloride?
The canonical SMILES for 2-chlorobenzene-1,4-diamine;dihydrochloride is Cl.Cl.Nc1ccc(N)c(Cl)c1.
What is the InChIKey of 2-chlorobenzene-1,4-diamine;dihydrochloride?
The InChIKey is GJCLKJLIKKFYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2.2ClH/c7-5-3-4(8)1-2-6(5)9;;/h1-3H,8-9H2;2*1H.
What are the key properties of 2-chlorobenzene-1,4-diamine;dihydrochloride?
2-chlorobenzene-1,4-diamine;dihydrochloride has a molecular weight of 215.51 g/mol, XLogP of 2.35, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzene-1,4-diamine;dihydrochloride is sourced from PubChem (CID 11997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).