C15H20F4N2O3S — CID 119970100
2-methyl-1-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]sulfonylpiperazine (PubChem CID 119970100) has the molecular formula C15H20F4N2O3S and a molecular weight of 384.40 g/mol. Its IUPAC name is 2-methyl-1-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]sulfonylpiperazine.
| Compound Name | 2-methyl-1-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 119970100 |
| Molecular Formula | C15H20F4N2O3S |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 2-methyl-1-[3-(2,2,3,3-tetrafluoropropoxymethyl)phenyl]sulfonylpiperazine |
| SMILES | CC1CNCCN1S(=O)(=O)c1cccc(COCC(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C15H20F4N2O3S/c1-11-8-20-5-6-21(11)25(22,23)13-4-2-3-12(7-13)9-24-10-15(18,19)14(16)17/h2-4,7,11,14,20H,5-6,8-10H2,1H3 |
| InChIKey | RFPWKALFEYHBSG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|