C11H25N3O4S — CID 119970143
N,N-bis(2-methoxyethyl)-2-methylpiperazine-1-sulfonamide (PubChem CID 119970143) has the molecular formula C11H25N3O4S and a molecular weight of 295.41 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-2-methylpiperazine-1-sulfonamide.
| Compound Name | N,N-bis(2-methoxyethyl)-2-methylpiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 119970143 |
| Molecular Formula | C11H25N3O4S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-2-methylpiperazine-1-sulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)N1CCNCC1C |
| InChI | InChI=1S/C11H25N3O4S/c1-11-10-12-4-5-14(11)19(15,16)13(6-8-17-2)7-9-18-3/h11-12H,4-10H2,1-3H3 |
| InChIKey | JSOCJTGEUPFORN-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |