C13H18Cl2N2O4S — CID 119970165
methyl 4-chloro-2-(2-methylpiperazin-1-yl)sulfonylbenzoate;hydrochloride (PubChem CID 119970165) has the molecular formula C13H18Cl2N2O4S and a molecular weight of 369.27 g/mol. Its IUPAC name is methyl 4-chloro-2-(2-methylpiperazin-1-yl)sulfonylbenzoate;hydrochloride.
| Compound Name | methyl 4-chloro-2-(2-methylpiperazin-1-yl)sulfonylbenzoate;hydrochloride |
|---|---|
| PubChem CID | 119970165 |
| Molecular Formula | C13H18Cl2N2O4S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | methyl 4-chloro-2-(2-methylpiperazin-1-yl)sulfonylbenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(Cl)cc1S(=O)(=O)N1CCNCC1C.Cl |
| InChI | InChI=1S/C13H17ClN2O4S.ClH/c1-9-8-15-5-6-16(9)21(18,19)12-7-10(14)3-4-11(12)13(17)20-2;/h3-4,7,9,15H,5-6,8H2,1-2H3;1H |
| InChIKey | DUDIIRPJVHVXNX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |