C14H25ClN2O2S — CID 119973213
N-[2-(methylamino)ethyl]-4-(3-methylbutyl)benzenesulfonamide;hydrochloride (PubChem CID 119973213) has the molecular formula C14H25ClN2O2S and a molecular weight of 320.89 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-4-(3-methylbutyl)benzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(methylamino)ethyl]-4-(3-methylbutyl)benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119973213 |
| Molecular Formula | C14H25ClN2O2S |
| Molecular Weight | 320.89 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[2-(methylamino)ethyl]-4-(3-methylbutyl)benzenesulfonamide;hydrochloride |
| SMILES | CNCCNS(=O)(=O)c1ccc(CCC(C)C)cc1.Cl |
| InChI | InChI=1S/C14H24N2O2S.ClH/c1-12(2)4-5-13-6-8-14(9-7-13)19(17,18)16-11-10-15-3;/h6-9,12,15-16H,4-5,10-11H2,1-3H3;1H |
| InChIKey | BWEQVXUABXRBFY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.89 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|