C10H14Cl2N2O2S — CID 119973248
1-(2,6-dichlorophenyl)-N-[2-(methylamino)ethyl]methanesulfonamide (PubChem CID 119973248) has the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.21 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-N-[2-(methylamino)ethyl]methanesulfonamide.
| Compound Name | 1-(2,6-dichlorophenyl)-N-[2-(methylamino)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 119973248 |
| Molecular Formula | C10H14Cl2N2O2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-N-[2-(methylamino)ethyl]methanesulfonamide |
| SMILES | CNCCNS(=O)(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H14Cl2N2O2S/c1-13-5-6-14-17(15,16)7-8-9(11)3-2-4-10(8)12/h2-4,13-14H,5-7H2,1H3 |
| InChIKey | HHYRFTGOQXGYNX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|