C11H16BrN3O4S — CID 119975655
N-(1-amino-2-methylpropan-2-yl)-3-bromo-4-methyl-5-nitrobenzenesulfonamide (PubChem CID 119975655) has the molecular formula C11H16BrN3O4S and a molecular weight of 366.24 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-3-bromo-4-methyl-5-nitrobenzenesulfonamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-3-bromo-4-methyl-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 119975655 |
| Molecular Formula | C11H16BrN3O4S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-3-bromo-4-methyl-5-nitrobenzenesulfonamide |
| SMILES | Cc1c(Br)cc(S(=O)(=O)NC(C)(C)CN)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16BrN3O4S/c1-7-9(12)4-8(5-10(7)15(16)17)20(18,19)14-11(2,3)6-13/h4-5,14H,6,13H2,1-3H3 |
| InChIKey | IVWPYRRXVGTJSZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|