C8H21N3O3S — CID 119975712
1-amino-2-[[2-methoxyethyl(methyl)sulfamoyl]amino]-2-methylpropane (PubChem CID 119975712) has the molecular formula C8H21N3O3S and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-amino-2-[[2-methoxyethyl(methyl)sulfamoyl]amino]-2-methylpropane.
| Compound Name | 1-amino-2-[[2-methoxyethyl(methyl)sulfamoyl]amino]-2-methylpropane |
|---|---|
| PubChem CID | 119975712 |
| Molecular Formula | C8H21N3O3S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-amino-2-[[2-methoxyethyl(methyl)sulfamoyl]amino]-2-methylpropane |
| SMILES | COCCN(C)S(=O)(=O)NC(C)(C)CN |
| InChI | InChI=1S/C8H21N3O3S/c1-8(2,7-9)10-15(12,13)11(3)5-6-14-4/h10H,5-7,9H2,1-4H3 |
| InChIKey | LSJZKUMGUKMSJJ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |