About 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one
3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one (PubChem CID 11997642) has the molecular formula C16H15NO4
and a molecular weight of 285.30 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one.
Molecular Properties
| Compound Name | 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one |
| PubChem CID | 11997642 |
| Molecular Formula | C16H15NO4 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one |
| SMILES | COc1ccc(C2(O)c3ccccc3NC(=O)C2O)cc1 |
| InChI | InChI=1S/C16H15NO4/c1-21-11-8-6-10(7-9-11)16(20)12-4-2-3-5-13(12)17-15(19)14(16)18/h2-9,14,18,20H,1H3,(H,17,19) |
| InChIKey | VJLVPUFVTPJHDI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one?
The IUPAC name of 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one (CID 11997642) is 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one.
What is the SMILES notation for 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one?
The canonical SMILES for 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one is COc1ccc(C2(O)c3ccccc3NC(=O)C2O)cc1.
What is the InChIKey of 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one?
The InChIKey is VJLVPUFVTPJHDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO4/c1-21-11-8-6-10(7-9-11)16(20)12-4-2-3-5-13(12)17-15(19)14(16)18/h2-9,14,18,20H,1H3,(H,17,19).
What are the key properties of 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one?
3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one has a molecular weight of 285.30 g/mol, XLogP of 1.24, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-4-(4-methoxyphenyl)-1,3-dihydroquinolin-2-one is sourced from PubChem (CID 11997642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).