About N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride
N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride (PubChem CID 119976861) has the molecular formula C15H26ClN3O4S2
and a molecular weight of 411.98 g/mol. Its IUPAC name is N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride |
| PubChem CID | 119976861 |
| Molecular Formula | C15H26ClN3O4S2 |
| Molecular Weight | 411.98 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride |
| SMILES | CCCN(C1CCNC1)S(=O)(=O)CCNS(=O)(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C15H25N3O4S2.ClH/c1-2-11-18(14-8-9-16-13-14)23(19,20)12-10-17-24(21,22)15-6-4-3-5-7-15;/h3-7,14,16-17H,2,8-13H2,1H3;1H |
| InChIKey | UGWFRAAEKGZVCK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.98 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride?
The IUPAC name of N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride (CID 119976861) is N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride.
What is the SMILES notation for N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride?
The canonical SMILES for N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride is CCCN(C1CCNC1)S(=O)(=O)CCNS(=O)(=O)c1ccccc1.Cl.
What is the InChIKey of N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride?
The InChIKey is UGWFRAAEKGZVCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O4S2.ClH/c1-2-11-18(14-8-9-16-13-14)23(19,20)12-10-17-24(21,22)15-6-4-3-5-7-15;/h3-7,14,16-17H,2,8-13H2,1H3;1H.
What are the key properties of N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride?
N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride has a molecular weight of 411.98 g/mol, XLogP of 0.79, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[propyl(pyrrolidin-3-yl)sulfamoyl]ethyl]benzenesulfonamide;hydrochloride is sourced from PubChem (CID 119976861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).