C15H24ClN3O3S — CID 119977058
N-[4-(2-pyrrolidin-3-ylethylsulfamoyl)phenyl]propanamide;hydrochloride (PubChem CID 119977058) has the molecular formula C15H24ClN3O3S and a molecular weight of 361.90 g/mol. Its IUPAC name is N-[4-(2-pyrrolidin-3-ylethylsulfamoyl)phenyl]propanamide;hydrochloride.
| Compound Name | N-[4-(2-pyrrolidin-3-ylethylsulfamoyl)phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119977058 |
| Molecular Formula | C15H24ClN3O3S |
| Molecular Weight | 361.90 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | N-[4-(2-pyrrolidin-3-ylethylsulfamoyl)phenyl]propanamide;hydrochloride |
| SMILES | CCC(=O)Nc1ccc(S(=O)(=O)NCCC2CCNC2)cc1.Cl |
| InChI | InChI=1S/C15H23N3O3S.ClH/c1-2-15(19)18-13-3-5-14(6-4-13)22(20,21)17-10-8-12-7-9-16-11-12;/h3-6,12,16-17H,2,7-11H2,1H3,(H,18,19);1H |
| InChIKey | IQBPRXYQUPXQID-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.90 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |