About 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine
4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine (PubChem CID 11997718) has the molecular formula C20H14ClN5O2
and a molecular weight of 391.82 g/mol. Its IUPAC name is 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine.
Molecular Properties
| Compound Name | 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine |
| PubChem CID | 11997718 |
| Molecular Formula | C20H14ClN5O2 |
| Molecular Weight | 391.82 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine |
| SMILES | CC1(c2ccc([N+](=O)[O-])cc2)Nc2c(Cl)ncnc2-n2c1cc1ccccc12 |
| InChI | InChI=1S/C20H14ClN5O2/c1-20(13-6-8-14(9-7-13)26(27)28)16-10-12-4-2-3-5-15(12)25(16)19-17(24-20)18(21)22-11-23-19/h2-11,24H,1H3 |
| InChIKey | XQMQAMXZMMWKMG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.82 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine?
The IUPAC name of 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine (CID 11997718) is 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine.
What is the SMILES notation for 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine?
The canonical SMILES for 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine is CC1(c2ccc([N+](=O)[O-])cc2)Nc2c(Cl)ncnc2-n2c1cc1ccccc12.
What is the InChIKey of 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine?
The InChIKey is XQMQAMXZMMWKMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14ClN5O2/c1-20(13-6-8-14(9-7-13)26(27)28)16-10-12-4-2-3-5-15(12)25(16)19-17(24-20)18(21)22-11-23-19/h2-11,24H,1H3.
What are the key properties of 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine?
4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine has a molecular weight of 391.82 g/mol, XLogP of 4.67, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-methyl-6-(4-nitrophenyl)-5H-indolo[2,1-h]pteridine is sourced from PubChem (CID 11997718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).