C13H18BrN3O4S — CID 119977230
3-bromo-4-methyl-5-nitro-N-(2-pyrrolidin-3-ylethyl)benzenesulfonamide (PubChem CID 119977230) has the molecular formula C13H18BrN3O4S and a molecular weight of 392.28 g/mol. Its IUPAC name is 3-bromo-4-methyl-5-nitro-N-(2-pyrrolidin-3-ylethyl)benzenesulfonamide.
| Compound Name | 3-bromo-4-methyl-5-nitro-N-(2-pyrrolidin-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 119977230 |
| Molecular Formula | C13H18BrN3O4S |
| Molecular Weight | 392.28 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 3-bromo-4-methyl-5-nitro-N-(2-pyrrolidin-3-ylethyl)benzenesulfonamide |
| SMILES | Cc1c(Br)cc(S(=O)(=O)NCCC2CCNC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H18BrN3O4S/c1-9-12(14)6-11(7-13(9)17(18)19)22(20,21)16-5-3-10-2-4-15-8-10/h6-7,10,15-16H,2-5,8H2,1H3 |
| InChIKey | KQBHVYINLBGWOA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.28 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|