C15H20ClN3O4S — CID 119977325
2-methyl-1,3-dioxo-N-(2-pyrrolidin-3-ylethyl)isoindole-5-sulfonamide;hydrochloride (PubChem CID 119977325) has the molecular formula C15H20ClN3O4S and a molecular weight of 373.86 g/mol. Its IUPAC name is 2-methyl-1,3-dioxo-N-(2-pyrrolidin-3-ylethyl)isoindole-5-sulfonamide;hydrochloride.
| Compound Name | 2-methyl-1,3-dioxo-N-(2-pyrrolidin-3-ylethyl)isoindole-5-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119977325 |
| Molecular Formula | C15H20ClN3O4S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 2-methyl-1,3-dioxo-N-(2-pyrrolidin-3-ylethyl)isoindole-5-sulfonamide;hydrochloride |
| SMILES | CN1C(=O)c2ccc(S(=O)(=O)NCCC3CCNC3)cc2C1=O.Cl |
| InChI | InChI=1S/C15H19N3O4S.ClH/c1-18-14(19)12-3-2-11(8-13(12)15(18)20)23(21,22)17-7-5-10-4-6-16-9-10;/h2-3,8,10,16-17H,4-7,9H2,1H3;1H |
| InChIKey | CNVYDVUSJDKAFV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|