C13H20ClFN2O2S — CID 119980798
N-[1-(aminomethyl)cyclopentyl]-5-fluoro-2-methylbenzenesulfonamide;hydrochloride (PubChem CID 119980798) has the molecular formula C13H20ClFN2O2S and a molecular weight of 322.83 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-5-fluoro-2-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-5-fluoro-2-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119980798 |
| Molecular Formula | C13H20ClFN2O2S |
| Molecular Weight | 322.83 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-5-fluoro-2-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)NC1(CN)CCCC1.Cl |
| InChI | InChI=1S/C13H19FN2O2S.ClH/c1-10-4-5-11(14)8-12(10)19(17,18)16-13(9-15)6-2-3-7-13;/h4-5,8,16H,2-3,6-7,9,15H2,1H3;1H |
| InChIKey | BUTNSSRAURIUGG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.83 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |