About N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride
N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride (PubChem CID 119980924) has the molecular formula C12H21ClN4O4S
and a molecular weight of 352.84 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride.
Molecular Properties
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride |
| PubChem CID | 119980924 |
| Molecular Formula | C12H21ClN4O4S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride |
| SMILES | Cl.Cn1cc(S(=O)(=O)NC2(CN)CCCC2)c(=O)n(C)c1=O |
| InChI | InChI=1S/C12H20N4O4S.ClH/c1-15-7-9(10(17)16(2)11(15)18)21(19,20)14-12(8-13)5-3-4-6-12;/h7,14H,3-6,8,13H2,1-2H3;1H |
| InChIKey | ZRTZMBLPRFGUHV-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride?
The IUPAC name of N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride (CID 119980924) is N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride.
What is the SMILES notation for N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride?
The canonical SMILES for N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride is Cl.Cn1cc(S(=O)(=O)NC2(CN)CCCC2)c(=O)n(C)c1=O.
What is the InChIKey of N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride?
The InChIKey is ZRTZMBLPRFGUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O4S.ClH/c1-15-7-9(10(17)16(2)11(15)18)21(19,20)14-12(8-13)5-3-4-6-12;/h7,14H,3-6,8,13H2,1-2H3;1H.
What are the key properties of N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride?
N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride has a molecular weight of 352.84 g/mol, XLogP of -0.94, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(aminomethyl)cyclopentyl]-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide;hydrochloride is sourced from PubChem (CID 119980924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).