C13H20ClN3O2S — CID 119981457
N-[3-(aminomethyl)pentan-3-yl]-3-cyanobenzenesulfonamide;hydrochloride (PubChem CID 119981457) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is N-[3-(aminomethyl)pentan-3-yl]-3-cyanobenzenesulfonamide;hydrochloride.
| Compound Name | N-[3-(aminomethyl)pentan-3-yl]-3-cyanobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119981457 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | N-[3-(aminomethyl)pentan-3-yl]-3-cyanobenzenesulfonamide;hydrochloride |
| SMILES | CCC(CC)(CN)NS(=O)(=O)c1cccc(C#N)c1.Cl |
| InChI | InChI=1S/C13H19N3O2S.ClH/c1-3-13(4-2,10-15)16-19(17,18)12-7-5-6-11(8-12)9-14;/h5-8,16H,3-4,10,15H2,1-2H3;1H |
| InChIKey | ZDKKDWOOBWFCAA-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |