C22H23NO3 — CID 11998203
1'-pentylspiro[5,6-dihydrocyclopenta[f][1,3]benzodioxole-7,3'-indole]-2'-one (PubChem CID 11998203) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is 1'-pentylspiro[5,6-dihydrocyclopenta[f][1,3]benzodioxole-7,3'-indole]-2'-one.
| Compound Name | 1'-pentylspiro[5,6-dihydrocyclopenta[f][1,3]benzodioxole-7,3'-indole]-2'-one |
|---|---|
| PubChem CID | 11998203 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1'-pentylspiro[5,6-dihydrocyclopenta[f][1,3]benzodioxole-7,3'-indole]-2'-one |
| SMILES | CCCCCN1C(=O)C2(CCc3cc4c(cc32)OCO4)c2ccccc21 |
| InChI | InChI=1S/C22H23NO3/c1-2-3-6-11-23-18-8-5-4-7-16(18)22(21(23)24)10-9-15-12-19-20(13-17(15)22)26-14-25-19/h4-5,7-8,12-13H,2-3,6,9-11,14H2,1H3 |
| InChIKey | SKMITBUYSAXHIH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|