C25H25ClN4O2 — CID 11998404
2-chloro-N-[3-[[2-(1-pyridin-4-ylpiperidin-4-yl)acetyl]amino]phenyl]benzamide (PubChem CID 11998404) has the molecular formula C25H25ClN4O2 and a molecular weight of 448.95 g/mol. Its IUPAC name is 2-chloro-N-[3-[[2-(1-pyridin-4-ylpiperidin-4-yl)acetyl]amino]phenyl]benzamide.
| Compound Name | 2-chloro-N-[3-[[2-(1-pyridin-4-ylpiperidin-4-yl)acetyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 11998404 |
| Molecular Formula | C25H25ClN4O2 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 2-chloro-N-[3-[[2-(1-pyridin-4-ylpiperidin-4-yl)acetyl]amino]phenyl]benzamide |
| SMILES | O=C(CC1CCN(c2ccncc2)CC1)Nc1cccc(NC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C25H25ClN4O2/c26-23-7-2-1-6-22(23)25(32)29-20-5-3-4-19(17-20)28-24(31)16-18-10-14-30(15-11-18)21-8-12-27-13-9-21/h1-9,12-13,17-18H,10-11,14-16H2,(H,28,31)(H,29,32) |
| InChIKey | GOPVRJDEZGTCAO-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |