About 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride
1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride (PubChem CID 119985049) has the molecular formula C11H28ClN3O2S
and a molecular weight of 301.88 g/mol. Its IUPAC name is 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride.
Molecular Properties
| Compound Name | 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride |
| PubChem CID | 119985049 |
| Molecular Formula | C11H28ClN3O2S |
| Molecular Weight | 301.88 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride |
| SMILES | CC(C)CC(C)(CN)NS(=O)(=O)N(C)C(C)C.Cl |
| InChI | InChI=1S/C11H27N3O2S.ClH/c1-9(2)7-11(5,8-12)13-17(15,16)14(6)10(3)4;/h9-10,13H,7-8,12H2,1-6H3;1H |
| InChIKey | OTVNNRAXTFIDQA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.88 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride?
The IUPAC name of 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride (CID 119985049) is 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride.
What is the SMILES notation for 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride?
The canonical SMILES for 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride is CC(C)CC(C)(CN)NS(=O)(=O)N(C)C(C)C.Cl.
What is the InChIKey of 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride?
The InChIKey is OTVNNRAXTFIDQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N3O2S.ClH/c1-9(2)7-11(5,8-12)13-17(15,16)14(6)10(3)4;/h9-10,13H,7-8,12H2,1-6H3;1H.
What are the key properties of 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride?
1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride has a molecular weight of 301.88 g/mol, XLogP of 1.35, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-2,4-dimethyl-2-[[methyl(propan-2-yl)sulfamoyl]amino]pentane;hydrochloride is sourced from PubChem (CID 119985049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).